C17H24N4O — CID 86283608
7-cyclopentyl-2-pyridazin-3-yl-2,7-diazaspiro[4.5]decan-6-one (PubChem CID 86283608) has the molecular formula C17H24N4O and a molecular weight of 300.41 g/mol. Its IUPAC name is 7-cyclopentyl-2-pyridazin-3-yl-2,7-diazaspiro[4.5]decan-6-one.
| Compound Name | 7-cyclopentyl-2-pyridazin-3-yl-2,7-diazaspiro[4.5]decan-6-one |
|---|---|
| PubChem CID | 86283608 |
| Molecular Formula | C17H24N4O |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | 7-cyclopentyl-2-pyridazin-3-yl-2,7-diazaspiro[4.5]decan-6-one |
| SMILES | O=C1N(C2CCCC2)CCCC12CCN(c1cccnn1)C2 |
| InChI | InChI=1S/C17H24N4O/c22-16-17(8-4-11-21(16)14-5-1-2-6-14)9-12-20(13-17)15-7-3-10-18-19-15/h3,7,10,14H,1-2,4-6,8-9,11-13H2 |
| InChIKey | YLCYGTXYTGNQAK-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |