C19H27N3O3S — CID 72939411
7-cyclohexyl-2-pyridin-3-ylsulfonyl-2,7-diazaspiro[4.5]decan-6-one (PubChem CID 72939411) has the molecular formula C19H27N3O3S and a molecular weight of 377.51 g/mol. Its IUPAC name is 7-cyclohexyl-2-pyridin-3-ylsulfonyl-2,7-diazaspiro[4.5]decan-6-one.
| Compound Name | 7-cyclohexyl-2-pyridin-3-ylsulfonyl-2,7-diazaspiro[4.5]decan-6-one |
|---|---|
| PubChem CID | 72939411 |
| Molecular Formula | C19H27N3O3S |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | 7-cyclohexyl-2-pyridin-3-ylsulfonyl-2,7-diazaspiro[4.5]decan-6-one |
| SMILES | O=C1N(C2CCCCC2)CCCC12CCN(S(=O)(=O)c1cccnc1)C2 |
| InChI | InChI=1S/C19H27N3O3S/c23-18-19(9-5-12-22(18)16-6-2-1-3-7-16)10-13-21(15-19)26(24,25)17-8-4-11-20-14-17/h4,8,11,14,16H,1-3,5-7,9-10,12-13,15H2 |
| InChIKey | ZIIDZSKYTVTXIE-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |