C13H20ClN3O2S — CID 120718656
2-pyridin-3-ylsulfonyl-2,8-diazaspiro[4.5]decane;hydrochloride (PubChem CID 120718656) has the molecular formula C13H20ClN3O2S and a molecular weight of 317.84 g/mol. Its IUPAC name is 2-pyridin-3-ylsulfonyl-2,8-diazaspiro[4.5]decane;hydrochloride.
| Compound Name | 2-pyridin-3-ylsulfonyl-2,8-diazaspiro[4.5]decane;hydrochloride |
|---|---|
| PubChem CID | 120718656 |
| Molecular Formula | C13H20ClN3O2S |
| Molecular Weight | 317.84 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | 2-pyridin-3-ylsulfonyl-2,8-diazaspiro[4.5]decane;hydrochloride |
| SMILES | Cl.O=S(=O)(c1cccnc1)N1CCC2(CCNCC2)C1 |
| InChI | InChI=1S/C13H19N3O2S.ClH/c17-19(18,12-2-1-6-15-10-12)16-9-5-13(11-16)3-7-14-8-4-13;/h1-2,6,10,14H,3-5,7-9,11H2;1H |
| InChIKey | VOLFBRMWVJPHTI-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.84 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |