C14H19N3O4S — CID 120718684
2-(4-nitrophenyl)sulfonyl-2,8-diazaspiro[4.5]decane (PubChem CID 120718684) has the molecular formula C14H19N3O4S and a molecular weight of 325.39 g/mol. Its IUPAC name is 2-(4-nitrophenyl)sulfonyl-2,8-diazaspiro[4.5]decane.
| Compound Name | 2-(4-nitrophenyl)sulfonyl-2,8-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 120718684 |
| Molecular Formula | C14H19N3O4S |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | 2-(4-nitrophenyl)sulfonyl-2,8-diazaspiro[4.5]decane |
| SMILES | O=[N+]([O-])c1ccc(S(=O)(=O)N2CCC3(CCNCC3)C2)cc1 |
| InChI | InChI=1S/C14H19N3O4S/c18-17(19)12-1-3-13(4-2-12)22(20,21)16-10-7-14(11-16)5-8-15-9-6-14/h1-4,15H,5-11H2 |
| InChIKey | IRMBACAABOZVOL-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|