C12H18N4O2S — CID 66195772
1-(1-pyridin-3-ylsulfonylazetidin-3-yl)piperazine (PubChem CID 66195772) has the molecular formula C12H18N4O2S and a molecular weight of 282.37 g/mol. Its IUPAC name is 1-(1-pyridin-3-ylsulfonylazetidin-3-yl)piperazine.
| Compound Name | 1-(1-pyridin-3-ylsulfonylazetidin-3-yl)piperazine |
|---|---|
| PubChem CID | 66195772 |
| Molecular Formula | C12H18N4O2S |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 1-(1-pyridin-3-ylsulfonylazetidin-3-yl)piperazine |
| SMILES | O=S(=O)(c1cccnc1)N1CC(N2CCNCC2)C1 |
| InChI | InChI=1S/C12H18N4O2S/c17-19(18,12-2-1-3-14-8-12)16-9-11(10-16)15-6-4-13-5-7-15/h1-3,8,11,13H,4-7,9-10H2 |
| InChIKey | ICIAPMPVZMYAIZ-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |