C11H15N3O3S — CID 95815582
N,N-dimethyl-1-pyridin-3-ylsulfonylazetidine-3-carboxamide (PubChem CID 95815582) has the molecular formula C11H15N3O3S and a molecular weight of 269.33 g/mol. Its IUPAC name is N,N-dimethyl-1-pyridin-3-ylsulfonylazetidine-3-carboxamide.
| Compound Name | N,N-dimethyl-1-pyridin-3-ylsulfonylazetidine-3-carboxamide |
|---|---|
| PubChem CID | 95815582 |
| Molecular Formula | C11H15N3O3S |
| Molecular Weight | 269.33 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | N,N-dimethyl-1-pyridin-3-ylsulfonylazetidine-3-carboxamide |
| SMILES | CN(C)C(=O)C1CN(S(=O)(=O)c2cccnc2)C1 |
| InChI | InChI=1S/C11H15N3O3S/c1-13(2)11(15)9-7-14(8-9)18(16,17)10-4-3-5-12-6-10/h3-6,9H,7-8H2,1-2H3 |
| InChIKey | DWSYZHOUDWZMSK-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.33 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |