C19H29N3O3S — CID 46409150
N-(cyclohexylmethyl)-N-methyl-1-pyridin-3-ylsulfonylpiperidine-4-carboxamide (PubChem CID 46409150) has the molecular formula C19H29N3O3S and a molecular weight of 379.53 g/mol. Its IUPAC name is N-(cyclohexylmethyl)-N-methyl-1-pyridin-3-ylsulfonylpiperidine-4-carboxamide.
| Compound Name | N-(cyclohexylmethyl)-N-methyl-1-pyridin-3-ylsulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 46409150 |
| Molecular Formula | C19H29N3O3S |
| Molecular Weight | 379.53 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | N-(cyclohexylmethyl)-N-methyl-1-pyridin-3-ylsulfonylpiperidine-4-carboxamide |
| SMILES | CN(CC1CCCCC1)C(=O)C1CCN(S(=O)(=O)c2cccnc2)CC1 |
| InChI | InChI=1S/C19H29N3O3S/c1-21(15-16-6-3-2-4-7-16)19(23)17-9-12-22(13-10-17)26(24,25)18-8-5-11-20-14-18/h5,8,11,14,16-17H,2-4,6-7,9-10,12-13,15H2,1H3 |
| InChIKey | VJBUGWVDUQSVIE-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.53 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |