C10H17Cl2N3O2S — CID 165437566
1-pyridin-3-ylsulfonylpiperidin-3-amine;dihydrochloride (PubChem CID 165437566) has the molecular formula C10H17Cl2N3O2S and a molecular weight of 314.24 g/mol. Its IUPAC name is 1-pyridin-3-ylsulfonylpiperidin-3-amine;dihydrochloride.
| Compound Name | 1-pyridin-3-ylsulfonylpiperidin-3-amine;dihydrochloride |
|---|---|
| PubChem CID | 165437566 |
| Molecular Formula | C10H17Cl2N3O2S |
| Molecular Weight | 314.24 g/mol |
| Exact Mass | 313.04 |
| IUPAC Name | 1-pyridin-3-ylsulfonylpiperidin-3-amine;dihydrochloride |
| SMILES | Cl.Cl.NC1CCCN(S(=O)(=O)c2cccnc2)C1 |
| InChI | InChI=1S/C10H15N3O2S.2ClH/c11-9-3-2-6-13(8-9)16(14,15)10-4-1-5-12-7-10;;/h1,4-5,7,9H,2-3,6,8,11H2;2*1H |
| InChIKey | BKBURESLYSKQCF-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.24 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |