C11H13N3O3S — CID 24706355
3-(3-isocyanatopiperidin-1-yl)sulfonylpyridine (PubChem CID 24706355) has the molecular formula C11H13N3O3S and a molecular weight of 267.31 g/mol. Its IUPAC name is 3-(3-isocyanatopiperidin-1-yl)sulfonylpyridine.
| Compound Name | 3-(3-isocyanatopiperidin-1-yl)sulfonylpyridine |
|---|---|
| PubChem CID | 24706355 |
| Molecular Formula | C11H13N3O3S |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | 3-(3-isocyanatopiperidin-1-yl)sulfonylpyridine |
| SMILES | O=C=NC1CCCN(S(=O)(=O)c2cccnc2)C1 |
| InChI | InChI=1S/C11H13N3O3S/c15-9-13-10-3-2-6-14(8-10)18(16,17)11-4-1-5-12-7-11/h1,4-5,7,10H,2-3,6,8H2 |
| InChIKey | IWVMICJTMPRETP-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 79.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|