C11H18ClN3O2S — CID 119968968
(1-pyridin-3-ylsulfonylpiperidin-3-yl)methanamine;hydrochloride (PubChem CID 119968968) has the molecular formula C11H18ClN3O2S and a molecular weight of 291.80 g/mol. Its IUPAC name is (1-pyridin-3-ylsulfonylpiperidin-3-yl)methanamine;hydrochloride.
| Compound Name | (1-pyridin-3-ylsulfonylpiperidin-3-yl)methanamine;hydrochloride |
|---|---|
| PubChem CID | 119968968 |
| Molecular Formula | C11H18ClN3O2S |
| Molecular Weight | 291.80 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | (1-pyridin-3-ylsulfonylpiperidin-3-yl)methanamine;hydrochloride |
| SMILES | Cl.NCC1CCCN(S(=O)(=O)c2cccnc2)C1 |
| InChI | InChI=1S/C11H17N3O2S.ClH/c12-7-10-3-2-6-14(9-10)17(15,16)11-4-1-5-13-8-11;/h1,4-5,8,10H,2-3,6-7,9,12H2;1H |
| InChIKey | UAHHHEQUKPAFNT-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.80 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |