C18H20F2N2O2S — CID 42522293
3-[(3R)-3-[2-(3,4-difluorophenyl)ethyl]piperidin-1-yl]sulfonylpyridine (PubChem CID 42522293) has the molecular formula C18H20F2N2O2S and a molecular weight of 366.43 g/mol. Its IUPAC name is 3-[(3R)-3-[2-(3,4-difluorophenyl)ethyl]piperidin-1-yl]sulfonylpyridine.
| Compound Name | 3-[(3R)-3-[2-(3,4-difluorophenyl)ethyl]piperidin-1-yl]sulfonylpyridine |
|---|---|
| PubChem CID | 42522293 |
| Molecular Formula | C18H20F2N2O2S |
| Molecular Weight | 366.43 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 3-[(3R)-3-[2-(3,4-difluorophenyl)ethyl]piperidin-1-yl]sulfonylpyridine |
| SMILES | O=S(=O)(c1cccnc1)N1CCC[C@@H](CCc2ccc(F)c(F)c2)C1 |
| InChI | InChI=1S/C18H20F2N2O2S/c19-17-8-7-14(11-18(17)20)5-6-15-3-2-10-22(13-15)25(23,24)16-4-1-9-21-12-16/h1,4,7-9,11-12,15H,2-3,5-6,10,13H2/t15-/m0/s1 |
| InChIKey | QAQSIJYSOMNKIC-HNNXBMFYSA-N |
| XLogP | 3.39 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.43 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |