C12H17N3O2S — CID 120719570
9-pyridin-3-ylsulfonyl-3,9-diazabicyclo[4.2.1]nonane (PubChem CID 120719570) has the molecular formula C12H17N3O2S and a molecular weight of 267.35 g/mol. Its IUPAC name is 9-pyridin-3-ylsulfonyl-3,9-diazabicyclo[4.2.1]nonane.
| Compound Name | 9-pyridin-3-ylsulfonyl-3,9-diazabicyclo[4.2.1]nonane |
|---|---|
| PubChem CID | 120719570 |
| Molecular Formula | C12H17N3O2S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 9-pyridin-3-ylsulfonyl-3,9-diazabicyclo[4.2.1]nonane |
| SMILES | O=S(=O)(c1cccnc1)N1C2CCNCC1CC2 |
| InChI | InChI=1S/C12H17N3O2S/c16-18(17,12-2-1-6-13-9-12)15-10-3-4-11(15)8-14-7-5-10/h1-2,6,9-11,14H,3-5,7-8H2 |
| InChIKey | BTDYZRSPXXOTII-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |