About 5-[5-(2,8-diazaspiro[4.5]decan-2-ylsulfonyl)furan-2-yl]-1,2-oxazole;hydrochloride
5-[5-(2,8-diazaspiro[4.5]decan-2-ylsulfonyl)furan-2-yl]-1,2-oxazole;hydrochloride (PubChem CID 154887704) has the molecular formula C15H20ClN3O4S
and a molecular weight of 373.86 g/mol. Its IUPAC name is 5-[5-(2,8-diazaspiro[4.5]decan-2-ylsulfonyl)furan-2-yl]-1,2-oxazole;hydrochloride.
Molecular Properties
| Compound Name | 5-[5-(2,8-diazaspiro[4.5]decan-2-ylsulfonyl)furan-2-yl]-1,2-oxazole;hydrochloride |
| PubChem CID | 154887704 |
| Molecular Formula | C15H20ClN3O4S |
| Molecular Weight | 373.86 g/mol |
| Exact Mass | 373.09 |
| IUPAC Name | 5-[5-(2,8-diazaspiro[4.5]decan-2-ylsulfonyl)furan-2-yl]-1,2-oxazole;hydrochloride |
| SMILES | Cl.O=S(=O)(c1ccc(-c2ccno2)o1)N1CCC2(CCNCC2)C1 |
| InChI | InChI=1S/C15H19N3O4S.ClH/c19-23(20,14-2-1-12(21-14)13-3-7-17-22-13)18-10-6-15(11-18)4-8-16-9-5-15;/h1-3,7,16H,4-6,8-11H2;1H |
| InChIKey | FBXUCTZCCVBKEI-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 88.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.86 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-[5-(2,8-diazaspiro[4.5]decan-2-ylsulfonyl)furan-2-yl]-1,2-oxazole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[5-(2,8-diazaspiro[4.5]decan-2-ylsulfonyl)furan-2-yl]-1,2-oxazole;hydrochloride?
The IUPAC name of 5-[5-(2,8-diazaspiro[4.5]decan-2-ylsulfonyl)furan-2-yl]-1,2-oxazole;hydrochloride (CID 154887704) is 5-[5-(2,8-diazaspiro[4.5]decan-2-ylsulfonyl)furan-2-yl]-1,2-oxazole;hydrochloride.
What is the SMILES notation for 5-[5-(2,8-diazaspiro[4.5]decan-2-ylsulfonyl)furan-2-yl]-1,2-oxazole;hydrochloride?
The canonical SMILES for 5-[5-(2,8-diazaspiro[4.5]decan-2-ylsulfonyl)furan-2-yl]-1,2-oxazole;hydrochloride is Cl.O=S(=O)(c1ccc(-c2ccno2)o1)N1CCC2(CCNCC2)C1.
What is the InChIKey of 5-[5-(2,8-diazaspiro[4.5]decan-2-ylsulfonyl)furan-2-yl]-1,2-oxazole;hydrochloride?
The InChIKey is FBXUCTZCCVBKEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N3O4S.ClH/c19-23(20,14-2-1-12(21-14)13-3-7-17-22-13)18-10-6-15(11-18)4-8-16-9-5-15;/h1-3,7,16H,4-6,8-11H2;1H.
What are the key properties of 5-[5-(2,8-diazaspiro[4.5]decan-2-ylsulfonyl)furan-2-yl]-1,2-oxazole;hydrochloride?
5-[5-(2,8-diazaspiro[4.5]decan-2-ylsulfonyl)furan-2-yl]-1,2-oxazole;hydrochloride has a molecular weight of 373.86 g/mol, XLogP of 2.12, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[5-(2,8-diazaspiro[4.5]decan-2-ylsulfonyl)furan-2-yl]-1,2-oxazole;hydrochloride is sourced from PubChem (CID 154887704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).