C21H27FN4O — CID 118370054
2-[4-[(5R)-9-(6-fluoro-2-pyridinyl)-1-oxo-2,9-diazaspiro[4.5]decan-2-yl]cyclohexyl]acetonitrile (PubChem CID 118370054) has the molecular formula C21H27FN4O and a molecular weight of 370.47 g/mol. Its IUPAC name is 2-[4-[(5R)-9-(6-fluoro-2-pyridinyl)-1-oxo-2,9-diazaspiro[4.5]decan-2-yl]cyclohexyl]acetonitrile.
| Compound Name | 2-[4-[(5R)-9-(6-fluoro-2-pyridinyl)-1-oxo-2,9-diazaspiro[4.5]decan-2-yl]cyclohexyl]acetonitrile |
|---|---|
| PubChem CID | 118370054 |
| Molecular Formula | C21H27FN4O |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.22 |
| IUPAC Name | 2-[4-[(5R)-9-(6-fluoro-2-pyridinyl)-1-oxo-2,9-diazaspiro[4.5]decan-2-yl]cyclohexyl]acetonitrile |
| SMILES | N#CCC1CCC(N2CC[C@@]3(CCCN(c4cccc(F)n4)C3)C2=O)CC1 |
| InChI | InChI=1S/C21H27FN4O/c22-18-3-1-4-19(24-18)25-13-2-10-21(15-25)11-14-26(20(21)27)17-7-5-16(6-8-17)9-12-23/h1,3-4,16-17H,2,5-11,13-15H2/t16?,17?,21-/m1/s1 |
| InChIKey | TZHNIYGLBAQTIQ-MYKUNDNFSA-N |
| XLogP | 3.51 |
| TPSA | 60.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|