C21H30N2O3 — CID 72838415
7-(oxan-4-yl)-2-(2-phenoxyethyl)-2,7-diazaspiro[4.5]decan-6-one (PubChem CID 72838415) has the molecular formula C21H30N2O3 and a molecular weight of 358.48 g/mol. Its IUPAC name is 7-(oxan-4-yl)-2-(2-phenoxyethyl)-2,7-diazaspiro[4.5]decan-6-one.
| Compound Name | 7-(oxan-4-yl)-2-(2-phenoxyethyl)-2,7-diazaspiro[4.5]decan-6-one |
|---|---|
| PubChem CID | 72838415 |
| Molecular Formula | C21H30N2O3 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.23 |
| IUPAC Name | 7-(oxan-4-yl)-2-(2-phenoxyethyl)-2,7-diazaspiro[4.5]decan-6-one |
| SMILES | O=C1N(C2CCOCC2)CCCC12CCN(CCOc1ccccc1)C2 |
| InChI | InChI=1S/C21H30N2O3/c24-20-21(9-4-11-23(20)18-7-14-25-15-8-18)10-12-22(17-21)13-16-26-19-5-2-1-3-6-19/h1-3,5-6,18H,4,7-17H2 |
| InChIKey | PXGMYLCYRAANIR-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |