C11H12Cl3N3O — CID 885984
2,2,2-trichloro-1-(4-pyridin-2-ylpiperazin-1-yl)ethanone (PubChem CID 885984) has the molecular formula C11H12Cl3N3O and a molecular weight of 308.60 g/mol. Its IUPAC name is 2,2,2-trichloro-1-(4-pyridin-2-ylpiperazin-1-yl)ethanone.
| Compound Name | 2,2,2-trichloro-1-(4-pyridin-2-ylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 885984 |
| Molecular Formula | C11H12Cl3N3O |
| Molecular Weight | 308.60 g/mol |
| Exact Mass | 307.00 |
| IUPAC Name | 2,2,2-trichloro-1-(4-pyridin-2-ylpiperazin-1-yl)ethanone |
| SMILES | O=C(N1CCN(c2ccccn2)CC1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C11H12Cl3N3O/c12-11(13,14)10(18)17-7-5-16(6-8-17)9-3-1-2-4-15-9/h1-4H,5-8H2 |
| InChIKey | FXESXDMBOQQDRL-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.60 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|