C11H17N3 — CID 11790022
1-methyl-4-pyridin-2-yl-1,4-diazepane (PubChem CID 11790022) has the molecular formula C11H17N3 and a molecular weight of 191.28 g/mol. Its IUPAC name is 1-methyl-4-pyridin-2-yl-1,4-diazepane.
| Compound Name | 1-methyl-4-pyridin-2-yl-1,4-diazepane |
|---|---|
| PubChem CID | 11790022 |
| Molecular Formula | C11H17N3 |
| Molecular Weight | 191.28 g/mol |
| Exact Mass | 191.14 |
| IUPAC Name | 1-methyl-4-pyridin-2-yl-1,4-diazepane |
| SMILES | CN1CCCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C11H17N3/c1-13-7-4-8-14(10-9-13)11-5-2-3-6-12-11/h2-3,5-6H,4,7-10H2,1H3 |
| InChIKey | NPRDUFDWZCXDEE-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.28 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |