C11H17N3O2S — CID 47147001
1-methylsulfonyl-4-pyridin-2-yl-1,4-diazepane (PubChem CID 47147001) has the molecular formula C11H17N3O2S and a molecular weight of 255.34 g/mol. Its IUPAC name is 1-methylsulfonyl-4-pyridin-2-yl-1,4-diazepane.
| Compound Name | 1-methylsulfonyl-4-pyridin-2-yl-1,4-diazepane |
|---|---|
| PubChem CID | 47147001 |
| Molecular Formula | C11H17N3O2S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 1-methylsulfonyl-4-pyridin-2-yl-1,4-diazepane |
| SMILES | CS(=O)(=O)N1CCCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C11H17N3O2S/c1-17(15,16)14-8-4-7-13(9-10-14)11-5-2-3-6-12-11/h2-3,5-6H,4,7-10H2,1H3 |
| InChIKey | OKAGJZXXCADUOC-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |