C16H26N4O2S — CID 46981276
1-(4-methylpiperidin-1-yl)sulfonyl-4-pyridin-2-yl-1,4-diazepane (PubChem CID 46981276) has the molecular formula C16H26N4O2S and a molecular weight of 338.48 g/mol. Its IUPAC name is 1-(4-methylpiperidin-1-yl)sulfonyl-4-pyridin-2-yl-1,4-diazepane.
| Compound Name | 1-(4-methylpiperidin-1-yl)sulfonyl-4-pyridin-2-yl-1,4-diazepane |
|---|---|
| PubChem CID | 46981276 |
| Molecular Formula | C16H26N4O2S |
| Molecular Weight | 338.48 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | 1-(4-methylpiperidin-1-yl)sulfonyl-4-pyridin-2-yl-1,4-diazepane |
| SMILES | CC1CCN(S(=O)(=O)N2CCCN(c3ccccn3)CC2)CC1 |
| InChI | InChI=1S/C16H26N4O2S/c1-15-6-11-20(12-7-15)23(21,22)19-10-4-9-18(13-14-19)16-5-2-3-8-17-16/h2-3,5,8,15H,4,6-7,9-14H2,1H3 |
| InChIKey | HUYNSXRCZOPNCJ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.48 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |