C15H24N4O2S — CID 167750740
1-(2,2-dimethylpyrrolidin-1-yl)sulfonyl-4-pyridin-2-ylpiperazine (PubChem CID 167750740) has the molecular formula C15H24N4O2S and a molecular weight of 324.45 g/mol. Its IUPAC name is 1-(2,2-dimethylpyrrolidin-1-yl)sulfonyl-4-pyridin-2-ylpiperazine.
| Compound Name | 1-(2,2-dimethylpyrrolidin-1-yl)sulfonyl-4-pyridin-2-ylpiperazine |
|---|---|
| PubChem CID | 167750740 |
| Molecular Formula | C15H24N4O2S |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 1-(2,2-dimethylpyrrolidin-1-yl)sulfonyl-4-pyridin-2-ylpiperazine |
| SMILES | CC1(C)CCCN1S(=O)(=O)N1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C15H24N4O2S/c1-15(2)7-5-9-19(15)22(20,21)18-12-10-17(11-13-18)14-6-3-4-8-16-14/h3-4,6,8H,5,7,9-13H2,1-2H3 |
| InChIKey | KIJPITXJNUDBKE-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |