C15H15F2N3O2S — CID 3465215
1-(2,4-difluorophenyl)sulfonyl-4-pyridin-2-ylpiperazine (PubChem CID 3465215) has the molecular formula C15H15F2N3O2S and a molecular weight of 339.37 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)sulfonyl-4-pyridin-2-ylpiperazine.
| Compound Name | 1-(2,4-difluorophenyl)sulfonyl-4-pyridin-2-ylpiperazine |
|---|---|
| PubChem CID | 3465215 |
| Molecular Formula | C15H15F2N3O2S |
| Molecular Weight | 339.37 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | 1-(2,4-difluorophenyl)sulfonyl-4-pyridin-2-ylpiperazine |
| SMILES | O=S(=O)(c1ccc(F)cc1F)N1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C15H15F2N3O2S/c16-12-4-5-14(13(17)11-12)23(21,22)20-9-7-19(8-10-20)15-3-1-2-6-18-15/h1-6,11H,7-10H2 |
| InChIKey | YAKRBDJDQPAHGK-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.37 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |