C15H16F2N4O2S — CID 50947962
3-[4-(2,4-difluorophenyl)sulfonylpiperazin-1-yl]-6-methylpyridazine (PubChem CID 50947962) has the molecular formula C15H16F2N4O2S and a molecular weight of 354.38 g/mol. Its IUPAC name is 3-[4-(2,4-difluorophenyl)sulfonylpiperazin-1-yl]-6-methylpyridazine.
| Compound Name | 3-[4-(2,4-difluorophenyl)sulfonylpiperazin-1-yl]-6-methylpyridazine |
|---|---|
| PubChem CID | 50947962 |
| Molecular Formula | C15H16F2N4O2S |
| Molecular Weight | 354.38 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | 3-[4-(2,4-difluorophenyl)sulfonylpiperazin-1-yl]-6-methylpyridazine |
| SMILES | Cc1ccc(N2CCN(S(=O)(=O)c3ccc(F)cc3F)CC2)nn1 |
| InChI | InChI=1S/C15H16F2N4O2S/c1-11-2-5-15(19-18-11)20-6-8-21(9-7-20)24(22,23)14-4-3-12(16)10-13(14)17/h2-5,10H,6-9H2,1H3 |
| InChIKey | ZVVNDIKWWDMOCF-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.38 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |