C14H23N3O — CID 75506679
1-(2-ethoxyethyl)-4-pyridin-2-yl-1,4-diazepane (PubChem CID 75506679) has the molecular formula C14H23N3O and a molecular weight of 249.36 g/mol. Its IUPAC name is 1-(2-ethoxyethyl)-4-pyridin-2-yl-1,4-diazepane.
| Compound Name | 1-(2-ethoxyethyl)-4-pyridin-2-yl-1,4-diazepane |
|---|---|
| PubChem CID | 75506679 |
| Molecular Formula | C14H23N3O |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.18 |
| IUPAC Name | 1-(2-ethoxyethyl)-4-pyridin-2-yl-1,4-diazepane |
| SMILES | CCOCCN1CCCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C14H23N3O/c1-2-18-13-12-16-8-5-9-17(11-10-16)14-6-3-4-7-15-14/h3-4,6-7H,2,5,8-13H2,1H3 |
| InChIKey | LSWBWZFIQKSZQP-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|