C12H16N4 — CID 136531044
2-(4-pyridin-2-yl-1,4-diazepan-1-yl)acetonitrile (PubChem CID 136531044) has the molecular formula C12H16N4 and a molecular weight of 216.29 g/mol. Its IUPAC name is 2-(4-pyridin-2-yl-1,4-diazepan-1-yl)acetonitrile.
| Compound Name | 2-(4-pyridin-2-yl-1,4-diazepan-1-yl)acetonitrile |
|---|---|
| PubChem CID | 136531044 |
| Molecular Formula | C12H16N4 |
| Molecular Weight | 216.29 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | 2-(4-pyridin-2-yl-1,4-diazepan-1-yl)acetonitrile |
| SMILES | N#CCN1CCCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C12H16N4/c13-5-9-15-7-3-8-16(11-10-15)12-4-1-2-6-14-12/h1-2,4,6H,3,7-11H2 |
| InChIKey | PLPYNSTWBHZWPK-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 43.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.29 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|