C19H23N7S — CID 126555887
N-[(Z)-(1-methyl-2,3-dihydro-1,5-naphthyridin-4-ylidene)amino]-4-pyridin-2-ylpiperazine-1-carbothioamide (PubChem CID 126555887) has the molecular formula C19H23N7S and a molecular weight of 381.51 g/mol. Its IUPAC name is N-[(Z)-(1-methyl-2,3-dihydro-1,5-naphthyridin-4-ylidene)amino]-4-pyridin-2-ylpiperazine-1-carbothioamide.
| Compound Name | N-[(Z)-(1-methyl-2,3-dihydro-1,5-naphthyridin-4-ylidene)amino]-4-pyridin-2-ylpiperazine-1-carbothioamide |
|---|---|
| PubChem CID | 126555887 |
| Molecular Formula | C19H23N7S |
| Molecular Weight | 381.51 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | N-[(Z)-(1-methyl-2,3-dihydro-1,5-naphthyridin-4-ylidene)amino]-4-pyridin-2-ylpiperazine-1-carbothioamide |
| SMILES | CN1CC/C(=N/NC(=S)N2CCN(c3ccccn3)CC2)c2ncccc21 |
| InChI | InChI=1S/C19H23N7S/c1-24-10-7-15(18-16(24)5-4-9-21-18)22-23-19(27)26-13-11-25(12-14-26)17-6-2-3-8-20-17/h2-6,8-9H,7,10-14H2,1H3,(H,23,27)/b22-15- |
| InChIKey | JDYYXEBBVODQHZ-JCMHNJIXSA-N |
| XLogP | 1.72 |
| TPSA | 59.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.51 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|