C25H36N6S — CID 145256005
ethane;N-[(Z)-(1-methyl-2,3-dihydro-1,5-naphthyridin-4-ylidene)amino]-4-(4-propan-2-ylphenyl)piperazine-1-carbothioamide (PubChem CID 145256005) has the molecular formula C25H36N6S and a molecular weight of 452.67 g/mol. Its IUPAC name is ethane;N-[(Z)-(1-methyl-2,3-dihydro-1,5-naphthyridin-4-ylidene)amino]-4-(4-propan-2-ylphenyl)piperazine-1-carbothioamide.
| Compound Name | ethane;N-[(Z)-(1-methyl-2,3-dihydro-1,5-naphthyridin-4-ylidene)amino]-4-(4-propan-2-ylphenyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 145256005 |
| Molecular Formula | C25H36N6S |
| Molecular Weight | 452.67 g/mol |
| Exact Mass | 452.27 |
| IUPAC Name | ethane;N-[(Z)-(1-methyl-2,3-dihydro-1,5-naphthyridin-4-ylidene)amino]-4-(4-propan-2-ylphenyl)piperazine-1-carbothioamide |
| SMILES | CC.CC(C)c1ccc(N2CCN(C(=S)N/N=C3/CCN(C)c4cccnc43)CC2)cc1 |
| InChI | InChI=1S/C23H30N6S.C2H6/c1-17(2)18-6-8-19(9-7-18)28-13-15-29(16-14-28)23(30)26-25-20-10-12-27(3)21-5-4-11-24-22(20)21;1-2/h4-9,11,17H,10,12-16H2,1-3H3,(H,26,30);1-2H3/b25-20-; |
| InChIKey | ANZSCCKQYRGUQY-RKVLWQGQSA-N |
| XLogP | 4.47 |
| TPSA | 47.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.67 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|