C20H23N7OS — CID 126555923
N-[(Z)-(1-acetyl-2,3-dihydro-1,5-naphthyridin-4-ylidene)amino]-4-pyridin-4-ylpiperazine-1-carbothioamide (PubChem CID 126555923) has the molecular formula C20H23N7OS and a molecular weight of 409.52 g/mol. Its IUPAC name is N-[(Z)-(1-acetyl-2,3-dihydro-1,5-naphthyridin-4-ylidene)amino]-4-pyridin-4-ylpiperazine-1-carbothioamide.
| Compound Name | N-[(Z)-(1-acetyl-2,3-dihydro-1,5-naphthyridin-4-ylidene)amino]-4-pyridin-4-ylpiperazine-1-carbothioamide |
|---|---|
| PubChem CID | 126555923 |
| Molecular Formula | C20H23N7OS |
| Molecular Weight | 409.52 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | N-[(Z)-(1-acetyl-2,3-dihydro-1,5-naphthyridin-4-ylidene)amino]-4-pyridin-4-ylpiperazine-1-carbothioamide |
| SMILES | CC(=O)N1CC/C(=N/NC(=S)N2CCN(c3ccncc3)CC2)c2ncccc21 |
| InChI | InChI=1S/C20H23N7OS/c1-15(28)27-10-6-17(19-18(27)3-2-7-22-19)23-24-20(29)26-13-11-25(12-14-26)16-4-8-21-9-5-16/h2-5,7-9H,6,10-14H2,1H3,(H,24,29)/b23-17- |
| InChIKey | YTCVTTNMFVYDKJ-QJOMJCCJSA-N |
| XLogP | 1.63 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.52 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|