C14H20N6O2S2 — CID 137033739
N-[(Z)-2,3-dihydro-1H-1,5-naphthyridin-4-ylideneamino]-4-methylsulfonylpiperazine-1-carbothioamide (PubChem CID 137033739) has the molecular formula C14H20N6O2S2 and a molecular weight of 368.49 g/mol. Its IUPAC name is N-[(Z)-2,3-dihydro-1H-1,5-naphthyridin-4-ylideneamino]-4-methylsulfonylpiperazine-1-carbothioamide.
| Compound Name | N-[(Z)-2,3-dihydro-1H-1,5-naphthyridin-4-ylideneamino]-4-methylsulfonylpiperazine-1-carbothioamide |
|---|---|
| PubChem CID | 137033739 |
| Molecular Formula | C14H20N6O2S2 |
| Molecular Weight | 368.49 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | N-[(Z)-2,3-dihydro-1H-1,5-naphthyridin-4-ylideneamino]-4-methylsulfonylpiperazine-1-carbothioamide |
| SMILES | CS(=O)(=O)N1CCN(C(=S)N/N=C2/CCNc3cccnc32)CC1 |
| InChI | InChI=1S/C14H20N6O2S2/c1-24(21,22)20-9-7-19(8-10-20)14(23)18-17-12-4-6-15-11-3-2-5-16-13(11)12/h2-3,5,15H,4,6-10H2,1H3,(H,18,23)/b17-12- |
| InChIKey | PXMGPQCLOMFVRS-ATVHPVEESA-N |
| XLogP | 0.05 |
| TPSA | 89.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.49 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|