C20H23FN6S — CID 137086863
N-[(Z)-(7-fluoro-2,3-dihydro-1H-1,5-naphthyridin-4-ylidene)amino]-4-(3-methylphenyl)piperazine-1-carbothioamide (PubChem CID 137086863) has the molecular formula C20H23FN6S and a molecular weight of 398.51 g/mol. Its IUPAC name is N-[(Z)-(7-fluoro-2,3-dihydro-1H-1,5-naphthyridin-4-ylidene)amino]-4-(3-methylphenyl)piperazine-1-carbothioamide.
| Compound Name | N-[(Z)-(7-fluoro-2,3-dihydro-1H-1,5-naphthyridin-4-ylidene)amino]-4-(3-methylphenyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 137086863 |
| Molecular Formula | C20H23FN6S |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | N-[(Z)-(7-fluoro-2,3-dihydro-1H-1,5-naphthyridin-4-ylidene)amino]-4-(3-methylphenyl)piperazine-1-carbothioamide |
| SMILES | Cc1cccc(N2CCN(C(=S)N/N=C3/CCNc4cc(F)cnc43)CC2)c1 |
| InChI | InChI=1S/C20H23FN6S/c1-14-3-2-4-16(11-14)26-7-9-27(10-8-26)20(28)25-24-17-5-6-22-18-12-15(21)13-23-19(17)18/h2-4,11-13,22H,5-10H2,1H3,(H,25,28)/b24-17- |
| InChIKey | HQYJSZOQTZXGTQ-ULJHMMPZSA-N |
| XLogP | 2.75 |
| TPSA | 55.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|