C20H22FN5OS — CID 126556350
N-[(Z)-(6-fluoro-2,3-dihydropyrano[3,2-b]pyridin-4-ylidene)amino]-4-(4-methylphenyl)piperazine-1-carbothioamide (PubChem CID 126556350) has the molecular formula C20H22FN5OS and a molecular weight of 399.50 g/mol. Its IUPAC name is N-[(Z)-(6-fluoro-2,3-dihydropyrano[3,2-b]pyridin-4-ylidene)amino]-4-(4-methylphenyl)piperazine-1-carbothioamide.
| Compound Name | N-[(Z)-(6-fluoro-2,3-dihydropyrano[3,2-b]pyridin-4-ylidene)amino]-4-(4-methylphenyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 126556350 |
| Molecular Formula | C20H22FN5OS |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | N-[(Z)-(6-fluoro-2,3-dihydropyrano[3,2-b]pyridin-4-ylidene)amino]-4-(4-methylphenyl)piperazine-1-carbothioamide |
| SMILES | Cc1ccc(N2CCN(C(=S)N/N=C3/CCOc4ccc(F)nc43)CC2)cc1 |
| InChI | InChI=1S/C20H22FN5OS/c1-14-2-4-15(5-3-14)25-9-11-26(12-10-25)20(28)24-23-16-8-13-27-17-6-7-18(21)22-19(16)17/h2-7H,8-13H2,1H3,(H,24,28)/b23-16- |
| InChIKey | OPLSNNYSAVNYBN-KQWNVCNZSA-N |
| XLogP | 2.71 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|