C20H22ClN5OS — CID 135253728
N-[(Z)-(8-chloro-2,3-dihydropyrano[3,2-b]pyridin-4-ylidene)amino]-2-methyl-4-phenylpiperazine-1-carbothioamide (PubChem CID 135253728) has the molecular formula C20H22ClN5OS and a molecular weight of 415.95 g/mol. Its IUPAC name is N-[(Z)-(8-chloro-2,3-dihydropyrano[3,2-b]pyridin-4-ylidene)amino]-2-methyl-4-phenylpiperazine-1-carbothioamide.
| Compound Name | N-[(Z)-(8-chloro-2,3-dihydropyrano[3,2-b]pyridin-4-ylidene)amino]-2-methyl-4-phenylpiperazine-1-carbothioamide |
|---|---|
| PubChem CID | 135253728 |
| Molecular Formula | C20H22ClN5OS |
| Molecular Weight | 415.95 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | N-[(Z)-(8-chloro-2,3-dihydropyrano[3,2-b]pyridin-4-ylidene)amino]-2-methyl-4-phenylpiperazine-1-carbothioamide |
| SMILES | CC1CN(c2ccccc2)CCN1C(=S)N/N=C1/CCOc2c(Cl)ccnc21 |
| InChI | InChI=1S/C20H22ClN5OS/c1-14-13-25(15-5-3-2-4-6-15)10-11-26(14)20(28)24-23-17-8-12-27-19-16(21)7-9-22-18(17)19/h2-7,9,14H,8,10-13H2,1H3,(H,24,28)/b23-17- |
| InChIKey | WSNLCUMNAVJHEA-QJOMJCCJSA-N |
| XLogP | 3.31 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.95 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|