C14H20N2O2 — CID 110707926
ethyl 2-methyl-4-phenylpiperazine-1-carboxylate (PubChem CID 110707926) has the molecular formula C14H20N2O2 and a molecular weight of 248.33 g/mol. Its IUPAC name is ethyl 2-methyl-4-phenylpiperazine-1-carboxylate.
| Compound Name | ethyl 2-methyl-4-phenylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 110707926 |
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | ethyl 2-methyl-4-phenylpiperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(c2ccccc2)CC1C |
| InChI | InChI=1S/C14H20N2O2/c1-3-18-14(17)16-10-9-15(11-12(16)2)13-7-5-4-6-8-13/h4-8,12H,3,9-11H2,1-2H3 |
| InChIKey | XUCSEXGTZYYJLP-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |