C21H30N2O4 — CID 173307540
2-(2-methylprop-2-enoxy)ethyl 4-(2-methyl-4-phenylpiperazin-1-yl)-4-oxobutanoate (PubChem CID 173307540) has the molecular formula C21H30N2O4 and a molecular weight of 374.48 g/mol. Its IUPAC name is 2-(2-methylprop-2-enoxy)ethyl 4-(2-methyl-4-phenylpiperazin-1-yl)-4-oxobutanoate.
| Compound Name | 2-(2-methylprop-2-enoxy)ethyl 4-(2-methyl-4-phenylpiperazin-1-yl)-4-oxobutanoate |
|---|---|
| PubChem CID | 173307540 |
| Molecular Formula | C21H30N2O4 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | 2-(2-methylprop-2-enoxy)ethyl 4-(2-methyl-4-phenylpiperazin-1-yl)-4-oxobutanoate |
| SMILES | C=C(C)COCCOC(=O)CCC(=O)N1CCN(c2ccccc2)CC1C |
| InChI | InChI=1S/C21H30N2O4/c1-17(2)16-26-13-14-27-21(25)10-9-20(24)23-12-11-22(15-18(23)3)19-7-5-4-6-8-19/h4-8,18H,1,9-16H2,2-3H3 |
| InChIKey | MAMOKJXVLRVRFG-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|