C17H23ClN6S — CID 137033658
N-[(Z)-(8-chloro-2,3-dihydro-1H-1,5-naphthyridin-4-ylidene)amino]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine-2-carbothioamide (PubChem CID 137033658) has the molecular formula C17H23ClN6S and a molecular weight of 378.93 g/mol. Its IUPAC name is N-[(Z)-(8-chloro-2,3-dihydro-1H-1,5-naphthyridin-4-ylidene)amino]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine-2-carbothioamide.
| Compound Name | N-[(Z)-(8-chloro-2,3-dihydro-1H-1,5-naphthyridin-4-ylidene)amino]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine-2-carbothioamide |
|---|---|
| PubChem CID | 137033658 |
| Molecular Formula | C17H23ClN6S |
| Molecular Weight | 378.93 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | N-[(Z)-(8-chloro-2,3-dihydro-1H-1,5-naphthyridin-4-ylidene)amino]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine-2-carbothioamide |
| SMILES | S=C(N/N=C1/CCNc2c(Cl)ccnc21)N1CCN2CCCCC2C1 |
| InChI | InChI=1S/C17H23ClN6S/c18-13-4-6-20-16-14(5-7-19-15(13)16)21-22-17(25)24-10-9-23-8-2-1-3-12(23)11-24/h4,6,12,19H,1-3,5,7-11H2,(H,22,25)/b21-14- |
| InChIKey | ZRTPLFIBNXJYTD-STZFKDTASA-N |
| XLogP | 2.30 |
| TPSA | 55.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.93 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|