C22H30N6S — CID 145255824
N-[(Z)-2,3-dihydro-1H-1,5-naphthyridin-4-ylideneamino]-4-[(3E)-2,6-dimethylhepta-1,3,5-trien-4-yl]piperazine-1-carbothioamide (PubChem CID 145255824) has the molecular formula C22H30N6S and a molecular weight of 410.59 g/mol. Its IUPAC name is N-[(Z)-2,3-dihydro-1H-1,5-naphthyridin-4-ylideneamino]-4-[(3E)-2,6-dimethylhepta-1,3,5-trien-4-yl]piperazine-1-carbothioamide.
| Compound Name | N-[(Z)-2,3-dihydro-1H-1,5-naphthyridin-4-ylideneamino]-4-[(3E)-2,6-dimethylhepta-1,3,5-trien-4-yl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 145255824 |
| Molecular Formula | C22H30N6S |
| Molecular Weight | 410.59 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | N-[(Z)-2,3-dihydro-1H-1,5-naphthyridin-4-ylideneamino]-4-[(3E)-2,6-dimethylhepta-1,3,5-trien-4-yl]piperazine-1-carbothioamide |
| SMILES | C=C(C)/C=C(\C=C(C)C)N1CCN(C(=S)N/N=C2/CCNc3cccnc32)CC1 |
| InChI | InChI=1S/C22H30N6S/c1-16(2)14-18(15-17(3)4)27-10-12-28(13-11-27)22(29)26-25-20-7-9-23-19-6-5-8-24-21(19)20/h5-6,8,14-15,23H,1,7,9-13H2,2-4H3,(H,26,29)/b18-14+,25-20- |
| InChIKey | ZBWISJWIWGSPDU-BCZLEZCTSA-N |
| XLogP | 3.52 |
| TPSA | 55.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.59 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|