C16H20FN5OS — CID 135253701
4-cyclopropyl-N-[(Z)-(6-fluoro-2,3-dihydropyrano[3,2-b]pyridin-4-ylidene)amino]piperazine-1-carbothioamide (PubChem CID 135253701) has the molecular formula C16H20FN5OS and a molecular weight of 349.44 g/mol. Its IUPAC name is 4-cyclopropyl-N-[(Z)-(6-fluoro-2,3-dihydropyrano[3,2-b]pyridin-4-ylidene)amino]piperazine-1-carbothioamide.
| Compound Name | 4-cyclopropyl-N-[(Z)-(6-fluoro-2,3-dihydropyrano[3,2-b]pyridin-4-ylidene)amino]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 135253701 |
| Molecular Formula | C16H20FN5OS |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | 4-cyclopropyl-N-[(Z)-(6-fluoro-2,3-dihydropyrano[3,2-b]pyridin-4-ylidene)amino]piperazine-1-carbothioamide |
| SMILES | Fc1ccc2c(n1)/C(=N\NC(=S)N1CCN(C3CC3)CC1)CCO2 |
| InChI | InChI=1S/C16H20FN5OS/c17-14-4-3-13-15(18-14)12(5-10-23-13)19-20-16(24)22-8-6-21(7-9-22)11-1-2-11/h3-4,11H,1-2,5-10H2,(H,20,24)/b19-12- |
| InChIKey | FXJZHUYPBNSTOU-UNOMPAQXSA-N |
| XLogP | 1.36 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|