C15H18FN5O2S — CID 126555809
4-acetyl-N-[(Z)-(8-fluoro-2,3-dihydropyrano[3,2-b]pyridin-4-ylidene)amino]piperazine-1-carbothioamide (PubChem CID 126555809) has the molecular formula C15H18FN5O2S and a molecular weight of 351.41 g/mol. Its IUPAC name is 4-acetyl-N-[(Z)-(8-fluoro-2,3-dihydropyrano[3,2-b]pyridin-4-ylidene)amino]piperazine-1-carbothioamide.
| Compound Name | 4-acetyl-N-[(Z)-(8-fluoro-2,3-dihydropyrano[3,2-b]pyridin-4-ylidene)amino]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 126555809 |
| Molecular Formula | C15H18FN5O2S |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | 4-acetyl-N-[(Z)-(8-fluoro-2,3-dihydropyrano[3,2-b]pyridin-4-ylidene)amino]piperazine-1-carbothioamide |
| SMILES | CC(=O)N1CCN(C(=S)N/N=C2/CCOc3c(F)ccnc32)CC1 |
| InChI | InChI=1S/C15H18FN5O2S/c1-10(22)20-5-7-21(8-6-20)15(24)19-18-12-3-9-23-14-11(16)2-4-17-13(12)14/h2,4H,3,5-9H2,1H3,(H,19,24)/b18-12- |
| InChIKey | ZTVURFXZPYALRE-PDGQHHTCSA-N |
| XLogP | 0.75 |
| TPSA | 70.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|