C22H28N6OS — CID 145255821
N-[(Z)-[1-(1-hydroxyethyl)-2,3-dihydro-1,5-naphthyridin-4-ylidene]amino]-4-(2-methylphenyl)piperazine-1-carbothioamide (PubChem CID 145255821) has the molecular formula C22H28N6OS and a molecular weight of 424.57 g/mol. Its IUPAC name is N-[(Z)-[1-(1-hydroxyethyl)-2,3-dihydro-1,5-naphthyridin-4-ylidene]amino]-4-(2-methylphenyl)piperazine-1-carbothioamide.
| Compound Name | N-[(Z)-[1-(1-hydroxyethyl)-2,3-dihydro-1,5-naphthyridin-4-ylidene]amino]-4-(2-methylphenyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 145255821 |
| Molecular Formula | C22H28N6OS |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | N-[(Z)-[1-(1-hydroxyethyl)-2,3-dihydro-1,5-naphthyridin-4-ylidene]amino]-4-(2-methylphenyl)piperazine-1-carbothioamide |
| SMILES | Cc1ccccc1N1CCN(C(=S)N/N=C2/CCN(C(C)O)c3cccnc32)CC1 |
| InChI | InChI=1S/C22H28N6OS/c1-16-6-3-4-7-19(16)26-12-14-27(15-13-26)22(30)25-24-18-9-11-28(17(2)29)20-8-5-10-23-21(18)20/h3-8,10,17,29H,9,11-15H2,1-2H3,(H,25,30)/b24-18- |
| InChIKey | SYHFJPYMGTUZFA-MOHJPFBDSA-N |
| XLogP | 2.34 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|