C17H26N6S — CID 126555600
N-[(Z)-(1-methyl-2,3-dihydro-1,5-naphthyridin-4-ylidene)amino]-4-propan-2-ylpiperazine-1-carbothioamide (PubChem CID 126555600) has the molecular formula C17H26N6S and a molecular weight of 346.50 g/mol. Its IUPAC name is N-[(Z)-(1-methyl-2,3-dihydro-1,5-naphthyridin-4-ylidene)amino]-4-propan-2-ylpiperazine-1-carbothioamide.
| Compound Name | N-[(Z)-(1-methyl-2,3-dihydro-1,5-naphthyridin-4-ylidene)amino]-4-propan-2-ylpiperazine-1-carbothioamide |
|---|---|
| PubChem CID | 126555600 |
| Molecular Formula | C17H26N6S |
| Molecular Weight | 346.50 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | N-[(Z)-(1-methyl-2,3-dihydro-1,5-naphthyridin-4-ylidene)amino]-4-propan-2-ylpiperazine-1-carbothioamide |
| SMILES | CC(C)N1CCN(C(=S)N/N=C2/CCN(C)c3cccnc32)CC1 |
| InChI | InChI=1S/C17H26N6S/c1-13(2)22-9-11-23(12-10-22)17(24)20-19-14-6-8-21(3)15-5-4-7-18-16(14)15/h4-5,7,13H,6,8-12H2,1-3H3,(H,20,24)/b19-14- |
| InChIKey | PTCAQAHWHXQKDP-RGEXLXHISA-N |
| XLogP | 1.53 |
| TPSA | 47.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.50 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|