C15H22N6S — CID 126555626
4-methyl-N-[(Z)-(1-methyl-2,3-dihydro-1,5-naphthyridin-4-ylidene)amino]piperazine-1-carbothioamide (PubChem CID 126555626) has the molecular formula C15H22N6S and a molecular weight of 318.45 g/mol. Its IUPAC name is 4-methyl-N-[(Z)-(1-methyl-2,3-dihydro-1,5-naphthyridin-4-ylidene)amino]piperazine-1-carbothioamide.
| Compound Name | 4-methyl-N-[(Z)-(1-methyl-2,3-dihydro-1,5-naphthyridin-4-ylidene)amino]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 126555626 |
| Molecular Formula | C15H22N6S |
| Molecular Weight | 318.45 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | 4-methyl-N-[(Z)-(1-methyl-2,3-dihydro-1,5-naphthyridin-4-ylidene)amino]piperazine-1-carbothioamide |
| SMILES | CN1CCN(C(=S)N/N=C2/CCN(C)c3cccnc32)CC1 |
| InChI | InChI=1S/C15H22N6S/c1-19-8-10-21(11-9-19)15(22)18-17-12-5-7-20(2)13-4-3-6-16-14(12)13/h3-4,6H,5,7-11H2,1-2H3,(H,18,22)/b17-12- |
| InChIKey | LBZZQIKGKFAZME-ATVHPVEESA-N |
| XLogP | 0.75 |
| TPSA | 47.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.45 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|