C14H19FN6O2S2 — CID 137086869
N-[(Z)-(7-fluoro-2,3-dihydro-1H-1,5-naphthyridin-4-ylidene)amino]-4-methylsulfonylpiperazine-1-carbothioamide (PubChem CID 137086869) has the molecular formula C14H19FN6O2S2 and a molecular weight of 386.48 g/mol. Its IUPAC name is N-[(Z)-(7-fluoro-2,3-dihydro-1H-1,5-naphthyridin-4-ylidene)amino]-4-methylsulfonylpiperazine-1-carbothioamide.
| Compound Name | N-[(Z)-(7-fluoro-2,3-dihydro-1H-1,5-naphthyridin-4-ylidene)amino]-4-methylsulfonylpiperazine-1-carbothioamide |
|---|---|
| PubChem CID | 137086869 |
| Molecular Formula | C14H19FN6O2S2 |
| Molecular Weight | 386.48 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | N-[(Z)-(7-fluoro-2,3-dihydro-1H-1,5-naphthyridin-4-ylidene)amino]-4-methylsulfonylpiperazine-1-carbothioamide |
| SMILES | CS(=O)(=O)N1CCN(C(=S)N/N=C2/CCNc3cc(F)cnc32)CC1 |
| InChI | InChI=1S/C14H19FN6O2S2/c1-25(22,23)21-6-4-20(5-7-21)14(24)19-18-11-2-3-16-12-8-10(15)9-17-13(11)12/h8-9,16H,2-7H2,1H3,(H,19,24)/b18-11- |
| InChIKey | RTWBAOLQSGEZSA-WQRHYEAKSA-N |
| XLogP | 0.19 |
| TPSA | 89.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.48 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|