C22H25N7S — CID 126555637
4-(4-cyanophenyl)-N-methyl-N-[(Z)-(1-methyl-2,3-dihydro-1,5-naphthyridin-4-ylidene)amino]piperazine-1-carbothioamide (PubChem CID 126555637) has the molecular formula C22H25N7S and a molecular weight of 419.56 g/mol. Its IUPAC name is 4-(4-cyanophenyl)-N-methyl-N-[(Z)-(1-methyl-2,3-dihydro-1,5-naphthyridin-4-ylidene)amino]piperazine-1-carbothioamide.
| Compound Name | 4-(4-cyanophenyl)-N-methyl-N-[(Z)-(1-methyl-2,3-dihydro-1,5-naphthyridin-4-ylidene)amino]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 126555637 |
| Molecular Formula | C22H25N7S |
| Molecular Weight | 419.56 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | 4-(4-cyanophenyl)-N-methyl-N-[(Z)-(1-methyl-2,3-dihydro-1,5-naphthyridin-4-ylidene)amino]piperazine-1-carbothioamide |
| SMILES | CN(/N=C1/CCN(C)c2cccnc21)C(=S)N1CCN(c2ccc(C#N)cc2)CC1 |
| InChI | InChI=1S/C22H25N7S/c1-26-11-9-19(21-20(26)4-3-10-24-21)25-27(2)22(30)29-14-12-28(13-15-29)18-7-5-17(16-23)6-8-18/h3-8,10H,9,11-15H2,1-2H3/b25-19- |
| InChIKey | HUEGTHGLLZXMLW-PLRJNAJWSA-N |
| XLogP | 2.54 |
| TPSA | 62.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.56 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|