C17H24N4O — CID 133287871
4-[4-[2-(diethylamino)acetyl]piperazin-1-yl]benzonitrile (PubChem CID 133287871) has the molecular formula C17H24N4O and a molecular weight of 300.41 g/mol. Its IUPAC name is 4-[4-[2-(diethylamino)acetyl]piperazin-1-yl]benzonitrile.
| Compound Name | 4-[4-[2-(diethylamino)acetyl]piperazin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 133287871 |
| Molecular Formula | C17H24N4O |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | 4-[4-[2-(diethylamino)acetyl]piperazin-1-yl]benzonitrile |
| SMILES | CCN(CC)CC(=O)N1CCN(c2ccc(C#N)cc2)CC1 |
| InChI | InChI=1S/C17H24N4O/c1-3-19(4-2)14-17(22)21-11-9-20(10-12-21)16-7-5-15(13-18)6-8-16/h5-8H,3-4,9-12,14H2,1-2H3 |
| InChIKey | DQXWGTCVRGHLPH-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 50.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |