C22H31N5O3 — CID 143530105
2-(diethylamino)-1-[4-(4-pyrimidin-2-ylphenyl)piperazin-1-yl]ethanone;methyl formate (PubChem CID 143530105) has the molecular formula C22H31N5O3 and a molecular weight of 413.52 g/mol. Its IUPAC name is 2-(diethylamino)-1-[4-(4-pyrimidin-2-ylphenyl)piperazin-1-yl]ethanone;methyl formate.
| Compound Name | 2-(diethylamino)-1-[4-(4-pyrimidin-2-ylphenyl)piperazin-1-yl]ethanone;methyl formate |
|---|---|
| PubChem CID | 143530105 |
| Molecular Formula | C22H31N5O3 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.24 |
| IUPAC Name | 2-(diethylamino)-1-[4-(4-pyrimidin-2-ylphenyl)piperazin-1-yl]ethanone;methyl formate |
| SMILES | CCN(CC)CC(=O)N1CCN(c2ccc(-c3ncccn3)cc2)CC1.COC=O |
| InChI | InChI=1S/C20H27N5O.C2H4O2/c1-3-23(4-2)16-19(26)25-14-12-24(13-15-25)18-8-6-17(7-9-18)20-21-10-5-11-22-20;1-4-2-3/h5-11H,3-4,12-16H2,1-2H3;2H,1H3 |
| InChIKey | SECNFNXTMHKKFE-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 78.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|