C18H18N6S — CID 3525121
4-pyridin-2-yl-N-quinazolin-6-ylpiperazine-1-carbothioamide (PubChem CID 3525121) has the molecular formula C18H18N6S and a molecular weight of 350.45 g/mol. Its IUPAC name is 4-pyridin-2-yl-N-quinazolin-6-ylpiperazine-1-carbothioamide.
| Compound Name | 4-pyridin-2-yl-N-quinazolin-6-ylpiperazine-1-carbothioamide |
|---|---|
| PubChem CID | 3525121 |
| Molecular Formula | C18H18N6S |
| Molecular Weight | 350.45 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | 4-pyridin-2-yl-N-quinazolin-6-ylpiperazine-1-carbothioamide |
| SMILES | S=C(Nc1ccc2ncncc2c1)N1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C18H18N6S/c25-18(22-15-4-5-16-14(11-15)12-19-13-21-16)24-9-7-23(8-10-24)17-3-1-2-6-20-17/h1-6,11-13H,7-10H2,(H,22,25) |
| InChIKey | XYAFGXIRENJACT-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.45 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|