C28H22N8O — CID 126341158
4-pyridin-2-yl-N-quinoxalino[3,2-f][1,10]phenanthrolin-11-ylpiperazine-1-carboxamide (PubChem CID 126341158) has the molecular formula C28H22N8O and a molecular weight of 486.54 g/mol. Its IUPAC name is 4-pyridin-2-yl-N-quinoxalino[3,2-f][1,10]phenanthrolin-11-ylpiperazine-1-carboxamide.
| Compound Name | 4-pyridin-2-yl-N-quinoxalino[3,2-f][1,10]phenanthrolin-11-ylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 126341158 |
| Molecular Formula | C28H22N8O |
| Molecular Weight | 486.54 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | 4-pyridin-2-yl-N-quinoxalino[3,2-f][1,10]phenanthrolin-11-ylpiperazine-1-carboxamide |
| SMILES | O=C(Nc1ccc2nc3c4cccnc4c4ncccc4c3nc2c1)N1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C28H22N8O/c37-28(36-15-13-35(14-16-36)23-7-1-2-10-29-23)32-18-8-9-21-22(17-18)34-27-20-6-4-12-31-25(20)24-19(26(27)33-21)5-3-11-30-24/h1-12,17H,13-16H2,(H,32,37) |
| InChIKey | NIDAMJRMCJAOAW-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 100.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.54 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|