C17H18F2N4OS — CID 1080923
N-[3-(difluoromethoxy)phenyl]-4-pyridin-2-ylpiperazine-1-carbothioamide (PubChem CID 1080923) has the molecular formula C17H18F2N4OS and a molecular weight of 364.42 g/mol. Its IUPAC name is N-[3-(difluoromethoxy)phenyl]-4-pyridin-2-ylpiperazine-1-carbothioamide.
| Compound Name | N-[3-(difluoromethoxy)phenyl]-4-pyridin-2-ylpiperazine-1-carbothioamide |
|---|---|
| PubChem CID | 1080923 |
| Molecular Formula | C17H18F2N4OS |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | N-[3-(difluoromethoxy)phenyl]-4-pyridin-2-ylpiperazine-1-carbothioamide |
| SMILES | FC(F)Oc1cccc(NC(=S)N2CCN(c3ccccn3)CC2)c1 |
| InChI | InChI=1S/C17H18F2N4OS/c18-16(19)24-14-5-3-4-13(12-14)21-17(25)23-10-8-22(9-11-23)15-6-1-2-7-20-15/h1-7,12,16H,8-11H2,(H,21,25) |
| InChIKey | ORCCXFGGIWLWOS-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 40.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|