C18H19F2N3O2S — CID 2372157
N-[4-(difluoromethoxy)phenyl]-4-(2-hydroxyphenyl)piperazine-1-carbothioamide (PubChem CID 2372157) has the molecular formula C18H19F2N3O2S and a molecular weight of 379.43 g/mol. Its IUPAC name is N-[4-(difluoromethoxy)phenyl]-4-(2-hydroxyphenyl)piperazine-1-carbothioamide.
| Compound Name | N-[4-(difluoromethoxy)phenyl]-4-(2-hydroxyphenyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 2372157 |
| Molecular Formula | C18H19F2N3O2S |
| Molecular Weight | 379.43 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | N-[4-(difluoromethoxy)phenyl]-4-(2-hydroxyphenyl)piperazine-1-carbothioamide |
| SMILES | Oc1ccccc1N1CCN(C(=S)Nc2ccc(OC(F)F)cc2)CC1 |
| InChI | InChI=1S/C18H19F2N3O2S/c19-17(20)25-14-7-5-13(6-8-14)21-18(26)23-11-9-22(10-12-23)15-3-1-2-4-16(15)24/h1-8,17,24H,9-12H2,(H,21,26) |
| InChIKey | VHKBFXGTCQECBI-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 47.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.43 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|