C19H18F2N2OS — CID 8660250
N-[4-(difluoromethoxy)phenyl]-4-phenyl-3,6-dihydro-2H-pyridine-1-carbothioamide (PubChem CID 8660250) has the molecular formula C19H18F2N2OS and a molecular weight of 360.43 g/mol. Its IUPAC name is N-[4-(difluoromethoxy)phenyl]-4-phenyl-3,6-dihydro-2H-pyridine-1-carbothioamide.
| Compound Name | N-[4-(difluoromethoxy)phenyl]-4-phenyl-3,6-dihydro-2H-pyridine-1-carbothioamide |
|---|---|
| PubChem CID | 8660250 |
| Molecular Formula | C19H18F2N2OS |
| Molecular Weight | 360.43 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | N-[4-(difluoromethoxy)phenyl]-4-phenyl-3,6-dihydro-2H-pyridine-1-carbothioamide |
| SMILES | FC(F)Oc1ccc(NC(=S)N2CC=C(c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C19H18F2N2OS/c20-18(21)24-17-8-6-16(7-9-17)22-19(25)23-12-10-15(11-13-23)14-4-2-1-3-5-14/h1-10,18H,11-13H2,(H,22,25) |
| InChIKey | PNIIKVJHLMUUDS-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.43 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|