C19H21F2N3OS — CID 8600373
(2S)-N-[4-(difluoromethoxy)phenyl]-4-methyl-2-phenylpiperazine-1-carbothioamide (PubChem CID 8600373) has the molecular formula C19H21F2N3OS and a molecular weight of 377.46 g/mol. Its IUPAC name is (2S)-N-[4-(difluoromethoxy)phenyl]-4-methyl-2-phenylpiperazine-1-carbothioamide.
| Compound Name | (2S)-N-[4-(difluoromethoxy)phenyl]-4-methyl-2-phenylpiperazine-1-carbothioamide |
|---|---|
| PubChem CID | 8600373 |
| Molecular Formula | C19H21F2N3OS |
| Molecular Weight | 377.46 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | (2S)-N-[4-(difluoromethoxy)phenyl]-4-methyl-2-phenylpiperazine-1-carbothioamide |
| SMILES | CN1CCN(C(=S)Nc2ccc(OC(F)F)cc2)[C@@H](c2ccccc2)C1 |
| InChI | InChI=1S/C19H21F2N3OS/c1-23-11-12-24(17(13-23)14-5-3-2-4-6-14)19(26)22-15-7-9-16(10-8-15)25-18(20)21/h2-10,17-18H,11-13H2,1H3,(H,22,26)/t17-/m1/s1 |
| InChIKey | UGJLYRXYOWSHIO-QGZVFWFLSA-N |
| XLogP | 3.97 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.46 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|